C26H22N4O3S — CID 57190437
2-[4-[(5-cyano-4-phenylpyrimidin-2-yl)amino]phenyl]ethyl 2-methylbenzenesulfonate (PubChem CID 57190437) has the molecular formula C26H22N4O3S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-[4-[(5-cyano-4-phenylpyrimidin-2-yl)amino]phenyl]ethyl 2-methylbenzenesulfonate.
| Compound Name | 2-[4-[(5-cyano-4-phenylpyrimidin-2-yl)amino]phenyl]ethyl 2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57190437 |
| Molecular Formula | C26H22N4O3S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-[4-[(5-cyano-4-phenylpyrimidin-2-yl)amino]phenyl]ethyl 2-methylbenzenesulfonate |
| SMILES | Cc1ccccc1S(=O)(=O)OCCc1ccc(Nc2ncc(C#N)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C26H22N4O3S/c1-19-7-5-6-10-24(19)34(31,32)33-16-15-20-11-13-23(14-12-20)29-26-28-18-22(17-27)25(30-26)21-8-3-2-4-9-21/h2-14,18H,15-16H2,1H3,(H,28,29,30) |
| InChIKey | WWXGGSZKKOCXQN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|