C30H31N3O5S — CID 57223703
2-[4-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenoxy]ethyl 2-methylbenzenesulfonate (PubChem CID 57223703) has the molecular formula C30H31N3O5S and a molecular weight of 545.66 g/mol. Its IUPAC name is 2-[4-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenoxy]ethyl 2-methylbenzenesulfonate.
| Compound Name | 2-[4-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenoxy]ethyl 2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57223703 |
| Molecular Formula | C30H31N3O5S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 2-[4-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenoxy]ethyl 2-methylbenzenesulfonate |
| SMILES | COc1ccc2c(c1)-c1nc(Nc3ccc(OCCOS(=O)(=O)c4ccccc4C)cc3)ncc1CC2(C)C |
| InChI | InChI=1S/C30H31N3O5S/c1-20-7-5-6-8-27(20)39(34,35)38-16-15-37-23-11-9-22(10-12-23)32-29-31-19-21-18-30(2,3)26-14-13-24(36-4)17-25(26)28(21)33-29/h5-14,17,19H,15-16,18H2,1-4H3,(H,31,32,33) |
| InChIKey | BLVMMNOONAKHJO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|