C26H32N4O2 — CID 57162990
9-methoxy-6,6-dimethyl-N-[3-[2-(propan-2-ylamino)ethoxy]phenyl]-5H-benzo[h]quinazolin-2-amine (PubChem CID 57162990) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 9-methoxy-6,6-dimethyl-N-[3-[2-(propan-2-ylamino)ethoxy]phenyl]-5H-benzo[h]quinazolin-2-amine.
| Compound Name | 9-methoxy-6,6-dimethyl-N-[3-[2-(propan-2-ylamino)ethoxy]phenyl]-5H-benzo[h]quinazolin-2-amine |
|---|---|
| PubChem CID | 57162990 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 9-methoxy-6,6-dimethyl-N-[3-[2-(propan-2-ylamino)ethoxy]phenyl]-5H-benzo[h]quinazolin-2-amine |
| SMILES | COc1ccc2c(c1)-c1nc(Nc3cccc(OCCNC(C)C)c3)ncc1CC2(C)C |
| InChI | InChI=1S/C26H32N4O2/c1-17(2)27-11-12-32-21-8-6-7-19(13-21)29-25-28-16-18-15-26(3,4)23-10-9-20(31-5)14-22(23)24(18)30-25/h6-10,13-14,16-17,27H,11-12,15H2,1-5H3,(H,28,29,30) |
| InChIKey | GOEWBBRRIDFKKP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|