C22H23N5O — CID 57195545
3-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]benzenecarboximidamide (PubChem CID 57195545) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]benzenecarboximidamide.
| Compound Name | 3-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 57195545 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(Nc2ncc3c(n2)-c2cc(OC)ccc2C(C)(C)C3)c1 |
| InChI | InChI=1S/C22H23N5O/c1-22(2)11-14-12-25-21(26-15-6-4-5-13(9-15)20(23)24)27-19(14)17-10-16(28-3)7-8-18(17)22/h4-10,12H,11H2,1-3H3,(H3,23,24)(H,25,26,27) |
| InChIKey | UZZHLNXHAQTFSM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|