C22H22N4O2 — CID 57163912
N-[3-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenyl]formamide (PubChem CID 57163912) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[3-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenyl]formamide.
| Compound Name | N-[3-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenyl]formamide |
|---|---|
| PubChem CID | 57163912 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[3-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenyl]formamide |
| SMILES | COc1ccc2c(c1)-c1nc(Nc3cccc(NC=O)c3)ncc1CC2(C)C |
| InChI | InChI=1S/C22H22N4O2/c1-22(2)11-14-12-23-21(25-16-6-4-5-15(9-16)24-13-27)26-20(14)18-10-17(28-3)7-8-19(18)22/h4-10,12-13H,11H2,1-3H3,(H,24,27)(H,23,25,26) |
| InChIKey | GGRXHOJTMJZARX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|