C22H23N3O3 — CID 57126257
2-methoxy-4-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenol (PubChem CID 57126257) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-methoxy-4-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenol.
| Compound Name | 2-methoxy-4-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenol |
|---|---|
| PubChem CID | 57126257 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-methoxy-4-[(9-methoxy-6,6-dimethyl-5H-benzo[h]quinazolin-2-yl)amino]phenol |
| SMILES | COc1ccc2c(c1)-c1nc(Nc3ccc(O)c(OC)c3)ncc1CC2(C)C |
| InChI | InChI=1S/C22H23N3O3/c1-22(2)11-13-12-23-21(24-14-5-8-18(26)19(9-14)28-4)25-20(13)16-10-15(27-3)6-7-17(16)22/h5-10,12,26H,11H2,1-4H3,(H,23,24,25) |
| InChIKey | BCVTZDXZDOZFLM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|