C18H18BrN — CID 57191316
6-bromo-N-(1-phenylethyl)-3,4-dihydro-1H-naphthalen-2-imine (PubChem CID 57191316) has the molecular formula C18H18BrN and a molecular weight of 328.25 g/mol. Its IUPAC name is 6-bromo-N-(1-phenylethyl)-3,4-dihydro-1H-naphthalen-2-imine.
| Compound Name | 6-bromo-N-(1-phenylethyl)-3,4-dihydro-1H-naphthalen-2-imine |
|---|---|
| PubChem CID | 57191316 |
| Molecular Formula | C18H18BrN |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 6-bromo-N-(1-phenylethyl)-3,4-dihydro-1H-naphthalen-2-imine |
| SMILES | CC(/N=C1\CCc2cc(Br)ccc2C1)c1ccccc1 |
| InChI | InChI=1S/C18H18BrN/c1-13(14-5-3-2-4-6-14)20-18-10-8-15-11-17(19)9-7-16(15)12-18/h2-7,9,11,13H,8,10,12H2,1H3/b20-18+ |
| InChIKey | TYTZPSYYYZEGPF-CZIZESTLSA-N |
| XLogP | 5.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|