C16H10S2 — CID 57191406
pyrene-1,6-dithiol (PubChem CID 57191406) has the molecular formula C16H10S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is pyrene-1,6-dithiol.
| Compound Name | pyrene-1,6-dithiol |
|---|---|
| PubChem CID | 57191406 |
| Molecular Formula | C16H10S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | pyrene-1,6-dithiol |
| SMILES | Sc1ccc2ccc3c(S)ccc4ccc1c2c43 |
| InChI | InChI=1S/C16H10S2/c17-13-8-4-10-2-6-12-14(18)7-3-9-1-5-11(13)16(10)15(9)12/h1-8,17-18H |
| InChIKey | IAPGMJRAFIBTIB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|