C16H6Cl4S — CID 167515635
5,6,7,8-tetrachloropyrene-4-thiol (PubChem CID 167515635) has the molecular formula C16H6Cl4S and a molecular weight of 372.10 g/mol. Its IUPAC name is 5,6,7,8-tetrachloropyrene-4-thiol.
| Compound Name | 5,6,7,8-tetrachloropyrene-4-thiol |
|---|---|
| PubChem CID | 167515635 |
| Molecular Formula | C16H6Cl4S |
| Molecular Weight | 372.10 g/mol |
| Exact Mass | 369.89 |
| IUPAC Name | 5,6,7,8-tetrachloropyrene-4-thiol |
| SMILES | Sc1c(Cl)c2c(Cl)c(Cl)c(Cl)c3ccc4cccc1c4c32 |
| InChI | InChI=1S/C16H6Cl4S/c17-12-7-5-4-6-2-1-3-8-9(6)10(7)11(13(18)15(12)20)14(19)16(8)21/h1-5,21H |
| InChIKey | DMEYSEQEYWKKQL-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.10 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|