C33H51N3O2S3 — CID 57192838
4-methyl-N,N-bis[3-(1H-pyrrol-2-yl)-3-(2-sulfanylethyl)heptyl]benzenesulfonamide (PubChem CID 57192838) has the molecular formula C33H51N3O2S3 and a molecular weight of 617.99 g/mol. Its IUPAC name is 4-methyl-N,N-bis[3-(1H-pyrrol-2-yl)-3-(2-sulfanylethyl)heptyl]benzenesulfonamide.
| Compound Name | 4-methyl-N,N-bis[3-(1H-pyrrol-2-yl)-3-(2-sulfanylethyl)heptyl]benzenesulfonamide |
|---|---|
| PubChem CID | 57192838 |
| Molecular Formula | C33H51N3O2S3 |
| Molecular Weight | 617.99 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | 4-methyl-N,N-bis[3-(1H-pyrrol-2-yl)-3-(2-sulfanylethyl)heptyl]benzenesulfonamide |
| SMILES | CCCCC(CCS)(CCN(CCC(CCS)(CCCC)c1ccc[nH]1)S(=O)(=O)c1ccc(C)cc1)c1ccc[nH]1 |
| InChI | InChI=1S/C33H51N3O2S3/c1-4-6-16-32(20-26-39,30-10-8-22-34-30)18-24-36(41(37,38)29-14-12-28(3)13-15-29)25-19-33(21-27-40,17-7-5-2)31-11-9-23-35-31/h8-15,22-23,34-35,39-40H,4-7,16-21,24-27H2,1-3H3 |
| InChIKey | FWOCCZHQLBWODI-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.99 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|