C16H17F3O3S — CID 57198329
propyl 4-methylsulfanyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanoate (PubChem CID 57198329) has the molecular formula C16H17F3O3S and a molecular weight of 346.37 g/mol. Its IUPAC name is propyl 4-methylsulfanyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanoate.
| Compound Name | propyl 4-methylsulfanyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanoate |
|---|---|
| PubChem CID | 57198329 |
| Molecular Formula | C16H17F3O3S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | propyl 4-methylsulfanyl-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanoate |
| SMILES | CCCOC(=O)C(=Cc1ccc(C(F)(F)F)cc1)C(=O)CSC |
| InChI | InChI=1S/C16H17F3O3S/c1-3-8-22-15(21)13(14(20)10-23-2)9-11-4-6-12(7-5-11)16(17,18)19/h4-7,9H,3,8,10H2,1-2H3 |
| InChIKey | ABOFPUZRHHBGAZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|