C21H20N2O5 — CID 57201544
1-O-(9H-fluoren-9-ylmethyl) 3-O-methyl 2-amino-2-(2-isocyanatoethyl)propanedioate (PubChem CID 57201544) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 1-O-(9H-fluoren-9-ylmethyl) 3-O-methyl 2-amino-2-(2-isocyanatoethyl)propanedioate.
| Compound Name | 1-O-(9H-fluoren-9-ylmethyl) 3-O-methyl 2-amino-2-(2-isocyanatoethyl)propanedioate |
|---|---|
| PubChem CID | 57201544 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-O-(9H-fluoren-9-ylmethyl) 3-O-methyl 2-amino-2-(2-isocyanatoethyl)propanedioate |
| SMILES | COC(=O)C(N)(CCN=C=O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H20N2O5/c1-27-19(25)21(22,10-11-23-13-24)20(26)28-12-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)18/h2-9,18H,10-12,22H2,1H3 |
| InChIKey | NJWMCDBSSOQZCC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|