C18H16N2O3 — CID 11415587
9H-fluoren-9-ylmethyl N-[(1R)-1-isocyanatoethyl]carbamate (PubChem CID 11415587) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(1R)-1-isocyanatoethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(1R)-1-isocyanatoethyl]carbamate |
|---|---|
| PubChem CID | 11415587 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(1R)-1-isocyanatoethyl]carbamate |
| SMILES | C[C@@H](N=C=O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H16N2O3/c1-12(19-11-21)20-18(22)23-10-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17H,10H2,1H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | YFCJAQCAZBKXEF-LBPRGKRZSA-N |
| XLogP | 3.21 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|