C19H21NO — CID 57202439
2,2,4-trimethyl-5,5a,10a,11-tetrahydro-4aH-indeno[1,2-g]quinolin-10-one (PubChem CID 57202439) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 2,2,4-trimethyl-5,5a,10a,11-tetrahydro-4aH-indeno[1,2-g]quinolin-10-one.
| Compound Name | 2,2,4-trimethyl-5,5a,10a,11-tetrahydro-4aH-indeno[1,2-g]quinolin-10-one |
|---|---|
| PubChem CID | 57202439 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2,2,4-trimethyl-5,5a,10a,11-tetrahydro-4aH-indeno[1,2-g]quinolin-10-one |
| SMILES | CC1=CC(C)(C)N=C2CC3C(=O)c4ccccc4C3CC12 |
| InChI | InChI=1S/C19H21NO/c1-11-10-19(2,3)20-17-9-16-15(8-14(11)17)12-6-4-5-7-13(12)18(16)21/h4-7,10,14-16H,8-9H2,1-3H3 |
| InChIKey | CNJQLDWWCHMHHE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|