C6H14NO2S- — CID 57203135
2,3-dimethyl-1-(sulfinatoamino)butane (PubChem CID 57203135) has the molecular formula C6H14NO2S- and a molecular weight of 164.25 g/mol. Its IUPAC name is 2,3-dimethyl-1-(sulfinatoamino)butane.
| Compound Name | 2,3-dimethyl-1-(sulfinatoamino)butane |
|---|---|
| PubChem CID | 57203135 |
| Molecular Formula | C6H14NO2S- |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2,3-dimethyl-1-(sulfinatoamino)butane |
| SMILES | CC(C)C(C)CNS(=O)[O-] |
| InChI | InChI=1S/C6H15NO2S/c1-5(2)6(3)4-7-10(8)9/h5-7H,4H2,1-3H3,(H,8,9)/p-1 |
| InChIKey | BUFUHMGBIQTEGF-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|