C10H4Cl2F5NO2 — CID 57203864
4-chloro-3-(4-chloro-2,5-difluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol (PubChem CID 57203864) has the molecular formula C10H4Cl2F5NO2 and a molecular weight of 336.04 g/mol. Its IUPAC name is 4-chloro-3-(4-chloro-2,5-difluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol.
| Compound Name | 4-chloro-3-(4-chloro-2,5-difluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 57203864 |
| Molecular Formula | C10H4Cl2F5NO2 |
| Molecular Weight | 336.04 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | 4-chloro-3-(4-chloro-2,5-difluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)F)ONC(c2cc(F)c(Cl)cc2F)=C1Cl |
| InChI | InChI=1S/C10H4Cl2F5NO2/c11-4-2-5(13)3(1-6(4)14)7-8(12)9(19,20-18-7)10(15,16)17/h1-2,18-19H |
| InChIKey | RIADYRNJOPNSFG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|