C12H6Cl2F5NO3 — CID 57257156
[4-chloro-3-(4-chloro-2,5-difluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-yl] acetate (PubChem CID 57257156) has the molecular formula C12H6Cl2F5NO3 and a molecular weight of 378.08 g/mol. Its IUPAC name is [4-chloro-3-(4-chloro-2,5-difluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-yl] acetate.
| Compound Name | [4-chloro-3-(4-chloro-2,5-difluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-yl] acetate |
|---|---|
| PubChem CID | 57257156 |
| Molecular Formula | C12H6Cl2F5NO3 |
| Molecular Weight | 378.08 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | [4-chloro-3-(4-chloro-2,5-difluorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-yl] acetate |
| SMILES | CC(=O)OC1(C(F)(F)F)ONC(c2cc(F)c(Cl)cc2F)=C1Cl |
| InChI | InChI=1S/C12H6Cl2F5NO3/c1-4(21)22-11(12(17,18)19)10(14)9(20-23-11)5-2-8(16)6(13)3-7(5)15/h2-3,20H,1H3 |
| InChIKey | RTZJEPFBJHBPLM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.08 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|