C19H40N4O7 — CID 57204139
dimethyl 3,7,11,15-tetraamino-5,9,13-trihydroxyheptadecanedioate (PubChem CID 57204139) has the molecular formula C19H40N4O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is dimethyl 3,7,11,15-tetraamino-5,9,13-trihydroxyheptadecanedioate.
| Compound Name | dimethyl 3,7,11,15-tetraamino-5,9,13-trihydroxyheptadecanedioate |
|---|---|
| PubChem CID | 57204139 |
| Molecular Formula | C19H40N4O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | dimethyl 3,7,11,15-tetraamino-5,9,13-trihydroxyheptadecanedioate |
| SMILES | COC(=O)CC(N)CC(O)CC(N)CC(O)CC(N)CC(O)CC(N)CC(=O)OC |
| InChI | InChI=1S/C19H40N4O7/c1-29-18(27)9-13(22)7-16(25)5-11(20)3-15(24)4-12(21)6-17(26)8-14(23)10-19(28)30-2/h11-17,24-26H,3-10,20-23H2,1-2H3 |
| InChIKey | MMCMTVCVYCQWKH-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 217.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |