C11H24Cl2N2O5 — CID 88760531
dimethyl 3,7-diamino-5-hydroxynonanedioate;dihydrochloride (PubChem CID 88760531) has the molecular formula C11H24Cl2N2O5 and a molecular weight of 335.23 g/mol. Its IUPAC name is dimethyl 3,7-diamino-5-hydroxynonanedioate;dihydrochloride.
| Compound Name | dimethyl 3,7-diamino-5-hydroxynonanedioate;dihydrochloride |
|---|---|
| PubChem CID | 88760531 |
| Molecular Formula | C11H24Cl2N2O5 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | dimethyl 3,7-diamino-5-hydroxynonanedioate;dihydrochloride |
| SMILES | COC(=O)CC(N)CC(O)CC(N)CC(=O)OC.Cl.Cl |
| InChI | InChI=1S/C11H22N2O5.2ClH/c1-17-10(15)5-7(12)3-9(14)4-8(13)6-11(16)18-2;;/h7-9,14H,3-6,12-13H2,1-2H3;2*1H |
| InChIKey | NKIZVXMQUYJGSR-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |