C21H27NO3 — CID 57208209
(8S,9R,10S,13S,14S,17S)-9,17-dihydroxy-10,13-dimethyl-2-methylidene-3-oxo-6,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 57208209) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17S)-9,17-dihydroxy-10,13-dimethyl-2-methylidene-3-oxo-6,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8S,9R,10S,13S,14S,17S)-9,17-dihydroxy-10,13-dimethyl-2-methylidene-3-oxo-6,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 57208209 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (8S,9R,10S,13S,14S,17S)-9,17-dihydroxy-10,13-dimethyl-2-methylidene-3-oxo-6,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | C=C1C[C@@]2(C)C(=CC1=O)CC[C@H]1[C@@H]3CC[C@@](O)(C#N)[C@@]3(C)CC[C@@]12O |
| InChI | InChI=1S/C21H27NO3/c1-13-11-19(3)14(10-17(13)23)4-5-16-15-6-7-20(24,12-22)18(15,2)8-9-21(16,19)25/h10,15-16,24-25H,1,4-9,11H2,2-3H3/t15-,16-,18-,19-,20+,21+/m0/s1 |
| InChIKey | GDEWQIBBWMFPNE-NLNBCDFGSA-N |
| XLogP | 3.05 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|