C22H27FO5 — CID 57086689
(8S,9R,10S,13S,14S,17R)-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-1,6,7,8,11,12,14,15-octahydrocyclopenta[a]phenanthrene-2,3-dione (PubChem CID 57086689) has the molecular formula C22H27FO5 and a molecular weight of 390.45 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17R)-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-1,6,7,8,11,12,14,15-octahydrocyclopenta[a]phenanthrene-2,3-dione.
| Compound Name | (8S,9R,10S,13S,14S,17R)-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-1,6,7,8,11,12,14,15-octahydrocyclopenta[a]phenanthrene-2,3-dione |
|---|---|
| PubChem CID | 57086689 |
| Molecular Formula | C22H27FO5 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (8S,9R,10S,13S,14S,17R)-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-1,6,7,8,11,12,14,15-octahydrocyclopenta[a]phenanthrene-2,3-dione |
| SMILES | C=C1C[C@H]2[C@@H]3CCC4=CC(=O)C(=O)C[C@]4(C)[C@@]3(F)CC[C@]2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C22H27FO5/c1-12-8-15-14-5-4-13-9-16(25)17(26)10-20(13,3)21(14,23)7-6-19(15,2)22(12,28)18(27)11-24/h9,14-15,24,28H,1,4-8,10-11H2,2-3H3/t14-,15-,19-,20-,21+,22-/m0/s1 |
| InChIKey | CYSYVKYBFXFKCI-ZUCLMVRBSA-N |
| XLogP | 2.25 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|