C22H29FO4 — CID 57159841
(8S,9R,10S,13S,14S,17S)-9-fluoro-3-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-1,3,6,7,8,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-2-one (PubChem CID 57159841) has the molecular formula C22H29FO4 and a molecular weight of 376.47 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17S)-9-fluoro-3-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-1,3,6,7,8,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-2-one.
| Compound Name | (8S,9R,10S,13S,14S,17S)-9-fluoro-3-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-1,3,6,7,8,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-2-one |
|---|---|
| PubChem CID | 57159841 |
| Molecular Formula | C22H29FO4 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (8S,9R,10S,13S,14S,17S)-9-fluoro-3-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-16-methylidene-1,3,6,7,8,11,12,14,15,17-decahydrocyclopenta[a]phenanthren-2-one |
| SMILES | C=C1C[C@H]2[C@@H]3CCC4=CC(O)C(=O)C[C@]4(C)[C@@]3(F)CC[C@]2(C)[C@H]1C(=O)CO |
| InChI | InChI=1S/C22H29FO4/c1-12-8-15-14-5-4-13-9-16(25)17(26)10-21(13,3)22(14,23)7-6-20(15,2)19(12)18(27)11-24/h9,14-16,19,24-25H,1,4-8,10-11H2,2-3H3/t14-,15-,16?,19+,20-,21-,22+/m0/s1 |
| InChIKey | RTVAYOJFUUDWQS-ZIRAPABKSA-N |
| XLogP | 2.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|