C22H24F2O4 — CID 57009370
(8R,9R,10S,13S,14S,17R)-17-acetyl-6,9-difluoro-17-hydroxy-10,13-dimethyl-16-methylidene-1,8,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-2,3-dione (PubChem CID 57009370) has the molecular formula C22H24F2O4 and a molecular weight of 390.43 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S,17R)-17-acetyl-6,9-difluoro-17-hydroxy-10,13-dimethyl-16-methylidene-1,8,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-2,3-dione.
| Compound Name | (8R,9R,10S,13S,14S,17R)-17-acetyl-6,9-difluoro-17-hydroxy-10,13-dimethyl-16-methylidene-1,8,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-2,3-dione |
|---|---|
| PubChem CID | 57009370 |
| Molecular Formula | C22H24F2O4 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (8R,9R,10S,13S,14S,17R)-17-acetyl-6,9-difluoro-17-hydroxy-10,13-dimethyl-16-methylidene-1,8,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-2,3-dione |
| SMILES | C=C1C[C@H]2[C@@H]3C=C(F)C4=CC(=O)C(=O)C[C@]4(C)[C@@]3(F)CC[C@]2(C)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C22H24F2O4/c1-11-7-13-14-8-16(23)15-9-17(26)18(27)10-20(15,4)21(14,24)6-5-19(13,3)22(11,28)12(2)25/h8-9,13-14,28H,1,5-7,10H2,2-4H3/t13-,14-,19-,20-,21+,22-/m0/s1 |
| InChIKey | SISLFVMXXHBMAP-ZMZASOQOSA-N |
| XLogP | 3.35 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|