C21H24ClFO5 — CID 57074038
(8R,9R,10S,13S,14S,17R)-6-chloro-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-8,11,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthrene-2,3-dione (PubChem CID 57074038) has the molecular formula C21H24ClFO5 and a molecular weight of 410.87 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S,17R)-6-chloro-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-8,11,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthrene-2,3-dione.
| Compound Name | (8R,9R,10S,13S,14S,17R)-6-chloro-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-8,11,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthrene-2,3-dione |
|---|---|
| PubChem CID | 57074038 |
| Molecular Formula | C21H24ClFO5 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (8R,9R,10S,13S,14S,17R)-6-chloro-9-fluoro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-8,11,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthrene-2,3-dione |
| SMILES | C[C@]12CC(=O)C(=O)C=C1C(Cl)=C[C@H]1[C@@H]3CC[C@](O)(C(=O)CO)[C@@]3(C)CC[C@@]12F |
| InChI | InChI=1S/C21H24ClFO5/c1-18-5-6-20(23)12(11(18)3-4-21(18,28)17(27)10-24)7-14(22)13-8-15(25)16(26)9-19(13,20)2/h7-8,11-12,24,28H,3-6,9-10H2,1-2H3/t11-,12-,18-,19-,20+,21-/m0/s1 |
| InChIKey | PZNUXYXSAJBACS-KRMJUEKQSA-N |
| XLogP | 2.42 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|