C22H28ClFO5 — CID 57263109
(8R,9R,10S,13S,14S,17R)-9-chloro-6-fluoro-2,17-dihydroxy-17-(2-hydroxyacetyl)-1,10,13-trimethyl-1,2,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57263109) has the molecular formula C22H28ClFO5 and a molecular weight of 426.91 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S,17R)-9-chloro-6-fluoro-2,17-dihydroxy-17-(2-hydroxyacetyl)-1,10,13-trimethyl-1,2,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10S,13S,14S,17R)-9-chloro-6-fluoro-2,17-dihydroxy-17-(2-hydroxyacetyl)-1,10,13-trimethyl-1,2,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57263109 |
| Molecular Formula | C22H28ClFO5 |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (8R,9R,10S,13S,14S,17R)-9-chloro-6-fluoro-2,17-dihydroxy-17-(2-hydroxyacetyl)-1,10,13-trimethyl-1,2,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1C(O)C(=O)C=C2C(F)=C[C@H]3[C@@H]4CC[C@](O)(C(=O)CO)[C@@]4(C)CC[C@]3(Cl)[C@]21C |
| InChI | InChI=1S/C22H28ClFO5/c1-11-18(28)16(26)9-14-15(24)8-13-12-4-5-22(29,17(27)10-25)19(12,2)6-7-21(13,23)20(11,14)3/h8-9,11-13,18,25,28-29H,4-7,10H2,1-3H3/t11?,12-,13-,18?,19-,20-,21+,22-/m0/s1 |
| InChIKey | WCEPIZOVZCECBN-WAQSYUHOSA-N |
| XLogP | 2.46 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|