C21H26BrFO5 — CID 70581688
(8S,9S,10S,13S,14S,17R)-2-bromo-6-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 70581688) has the molecular formula C21H26BrFO5 and a molecular weight of 457.34 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S,17R)-2-bromo-6-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10S,13S,14S,17R)-2-bromo-6-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70581688 |
| Molecular Formula | C21H26BrFO5 |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (8S,9S,10S,13S,14S,17R)-2-bromo-6-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=C(Br)C(=O)C=C1C(F)C[C@@H]1[C@@H]2C(O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO |
| InChI | InChI=1S/C21H26BrFO5/c1-19-7-13(22)15(25)6-12(19)14(23)5-10-11-3-4-21(28,17(27)9-24)20(11,2)8-16(26)18(10)19/h6-7,10-11,14,16,18,24,26,28H,3-5,8-9H2,1-2H3/t10-,11-,14?,16?,18+,19-,20-,21-/m0/s1 |
| InChIKey | BOFYRSUPOZGNMW-SBEURGGTSA-N |
| XLogP | 2.23 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|