C22H29ClO5 — CID 57201667
(8R,9S,10S,13S,14S,17R)-7-chloro-17-hydroxy-17-(2-hydroxyacetyl)-1,10,13-trimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-2,3-dione (PubChem CID 57201667) has the molecular formula C22H29ClO5 and a molecular weight of 408.92 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17R)-7-chloro-17-hydroxy-17-(2-hydroxyacetyl)-1,10,13-trimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-2,3-dione.
| Compound Name | (8R,9S,10S,13S,14S,17R)-7-chloro-17-hydroxy-17-(2-hydroxyacetyl)-1,10,13-trimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-2,3-dione |
|---|---|
| PubChem CID | 57201667 |
| Molecular Formula | C22H29ClO5 |
| Molecular Weight | 408.92 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (8R,9S,10S,13S,14S,17R)-7-chloro-17-hydroxy-17-(2-hydroxyacetyl)-1,10,13-trimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-2,3-dione |
| SMILES | CC1C(=O)C(=O)C=C2CC(Cl)[C@H]3[C@@H]4CC[C@](O)(C(=O)CO)[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C22H29ClO5/c1-11-19(27)16(25)9-12-8-15(23)18-13-5-7-22(28,17(26)10-24)20(13,2)6-4-14(18)21(11,12)3/h9,11,13-15,18,24,28H,4-8,10H2,1-3H3/t11?,13-,14-,15?,18-,20-,21-,22-/m0/s1 |
| InChIKey | XXIWIYSGMQAGNI-AYURGABASA-N |
| XLogP | 2.45 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.92 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|