C7H14F3NOSi — CID 57209186
3,3,3-trifluoro-2-methyl-2-trimethylsilylpropanamide (PubChem CID 57209186) has the molecular formula C7H14F3NOSi and a molecular weight of 213.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-trimethylsilylpropanamide.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-trimethylsilylpropanamide |
|---|---|
| PubChem CID | 57209186 |
| Molecular Formula | C7H14F3NOSi |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-trimethylsilylpropanamide |
| SMILES | CC(C(N)=O)(C(F)(F)F)[Si](C)(C)C |
| InChI | InChI=1S/C7H14F3NOSi/c1-6(5(11)12,7(8,9)10)13(2,3)4/h1-4H3,(H2,11,12) |
| InChIKey | LLSNAQSDTYPGBT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|