About ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate
ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate (PubChem CID 57209384) has the molecular formula C17H22O3
and a molecular weight of 274.36 g/mol. Its IUPAC name is ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate |
| PubChem CID | 57209384 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate |
| SMILES | CCOC(=O)CCc1ccc2c(c1)C(C)(C=O)CCC2 |
| InChI | InChI=1S/C17H22O3/c1-3-20-16(19)9-7-13-6-8-14-5-4-10-17(2,12-18)15(14)11-13/h6,8,11-12H,3-5,7,9-10H2,1-2H3 |
| InChIKey | KRHRAMJFXSWEFS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate?
The IUPAC name of ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate (CID 57209384) is ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate.
What is the SMILES notation for ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate?
The canonical SMILES for ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate is CCOC(=O)CCc1ccc2c(c1)C(C)(C=O)CCC2.
What is the InChIKey of ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate?
The InChIKey is KRHRAMJFXSWEFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O3/c1-3-20-16(19)9-7-13-6-8-14-5-4-10-17(2,12-18)15(14)11-13/h6,8,11-12H,3-5,7,9-10H2,1-2H3.
What are the key properties of ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate?
ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate has a molecular weight of 274.36 g/mol, XLogP of 2.98, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(8-formyl-8-methyl-6,7-dihydro-5H-naphthalen-2-yl)propanoate is sourced from PubChem (CID 57209384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).