About 3H-1,7-naphthyridine-2-thione
3H-1,7-naphthyridine-2-thione (PubChem CID 57209646) has the molecular formula C8H6N2S
and a molecular weight of 162.22 g/mol. Its IUPAC name is 3H-1,7-naphthyridine-2-thione.
Molecular Properties
| Compound Name | 3H-1,7-naphthyridine-2-thione |
| PubChem CID | 57209646 |
| Molecular Formula | C8H6N2S |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 3H-1,7-naphthyridine-2-thione |
| SMILES | S=C1CC=c2ccncc2=N1 |
| InChI | InChI=1S/C8H6N2S/c11-8-2-1-6-3-4-9-5-7(6)10-8/h1,3-5H,2H2 |
| InChIKey | ATAYMXUZBTVOAG-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,7-naphthyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,7-naphthyridine-2-thione?
The IUPAC name of 3H-1,7-naphthyridine-2-thione (CID 57209646) is 3H-1,7-naphthyridine-2-thione.
What is the SMILES notation for 3H-1,7-naphthyridine-2-thione?
The canonical SMILES for 3H-1,7-naphthyridine-2-thione is S=C1CC=c2ccncc2=N1.
What is the InChIKey of 3H-1,7-naphthyridine-2-thione?
The InChIKey is ATAYMXUZBTVOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S/c11-8-2-1-6-3-4-9-5-7(6)10-8/h1,3-5H,2H2.
What are the key properties of 3H-1,7-naphthyridine-2-thione?
3H-1,7-naphthyridine-2-thione has a molecular weight of 162.22 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,7-naphthyridine-2-thione is sourced from PubChem (CID 57209646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).