C12H12N2O4S — CID 57211622
3-pyridin-3-ylsulfonyl-3-(1H-pyrrol-2-yl)propanoic acid (PubChem CID 57211622) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-pyridin-3-ylsulfonyl-3-(1H-pyrrol-2-yl)propanoic acid.
| Compound Name | 3-pyridin-3-ylsulfonyl-3-(1H-pyrrol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 57211622 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-pyridin-3-ylsulfonyl-3-(1H-pyrrol-2-yl)propanoic acid |
| SMILES | O=C(O)CC(c1ccc[nH]1)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C12H12N2O4S/c15-12(16)7-11(10-4-2-6-14-10)19(17,18)9-3-1-5-13-8-9/h1-6,8,11,14H,7H2,(H,15,16) |
| InChIKey | PNHNVRIRXDJNOT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |