C19H18F3N3O2S — CID 57213144
2-methoxyimino-N-methyl-2-[2-[1-[[3-(trifluoromethyl)phenoxy]amino]ethenyl]phenyl]ethanethioamide (PubChem CID 57213144) has the molecular formula C19H18F3N3O2S and a molecular weight of 409.43 g/mol. Its IUPAC name is 2-methoxyimino-N-methyl-2-[2-[1-[[3-(trifluoromethyl)phenoxy]amino]ethenyl]phenyl]ethanethioamide.
| Compound Name | 2-methoxyimino-N-methyl-2-[2-[1-[[3-(trifluoromethyl)phenoxy]amino]ethenyl]phenyl]ethanethioamide |
|---|---|
| PubChem CID | 57213144 |
| Molecular Formula | C19H18F3N3O2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-methoxyimino-N-methyl-2-[2-[1-[[3-(trifluoromethyl)phenoxy]amino]ethenyl]phenyl]ethanethioamide |
| SMILES | C=C(NOc1cccc(C(F)(F)F)c1)c1ccccc1C(=NOC)C(=S)NC |
| InChI | InChI=1S/C19H18F3N3O2S/c1-12(24-27-14-8-6-7-13(11-14)19(20,21)22)15-9-4-5-10-16(15)17(25-26-3)18(28)23-2/h4-11,24H,1H2,2-3H3,(H,23,28) |
| InChIKey | NJPVQQUGLKVNCM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|