C15H31ClN4 — CID 57213268
1-chloro-N'-[4-(2-cyclohexylhydrazinyl)butyl]-N-prop-2-enylethane-1,2-diamine (PubChem CID 57213268) has the molecular formula C15H31ClN4 and a molecular weight of 302.89 g/mol. Its IUPAC name is 1-chloro-N'-[4-(2-cyclohexylhydrazinyl)butyl]-N-prop-2-enylethane-1,2-diamine.
| Compound Name | 1-chloro-N'-[4-(2-cyclohexylhydrazinyl)butyl]-N-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 57213268 |
| Molecular Formula | C15H31ClN4 |
| Molecular Weight | 302.89 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1-chloro-N'-[4-(2-cyclohexylhydrazinyl)butyl]-N-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCNC(Cl)CNCCCCNNC1CCCCC1 |
| InChI | InChI=1S/C15H31ClN4/c1-2-10-18-15(16)13-17-11-6-7-12-19-20-14-8-4-3-5-9-14/h2,14-15,17-20H,1,3-13H2 |
| InChIKey | QQHPPUDHWFHLOW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.89 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|