C16H31N3 — CID 146581503
N',N"-dicyclohexyl-N-prop-2-enylmethanetriamine (PubChem CID 146581503) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is N',N"-dicyclohexyl-N-prop-2-enylmethanetriamine.
| Compound Name | N',N"-dicyclohexyl-N-prop-2-enylmethanetriamine |
|---|---|
| PubChem CID | 146581503 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | N',N"-dicyclohexyl-N-prop-2-enylmethanetriamine |
| SMILES | C=CCNC(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C16H31N3/c1-2-13-17-16(18-14-9-5-3-6-10-14)19-15-11-7-4-8-12-15/h2,14-19H,1,3-13H2 |
| InChIKey | LBUBXZYQTXPRHW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|