C18H18N2O5S2 — CID 57214954
(4R)-3-[(2S)-3-acetylsulfanyl-4-(3-cyanophenyl)-2-methyl-4-oxobutanoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 57214954) has the molecular formula C18H18N2O5S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (4R)-3-[(2S)-3-acetylsulfanyl-4-(3-cyanophenyl)-2-methyl-4-oxobutanoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-[(2S)-3-acetylsulfanyl-4-(3-cyanophenyl)-2-methyl-4-oxobutanoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 57214954 |
| Molecular Formula | C18H18N2O5S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | (4R)-3-[(2S)-3-acetylsulfanyl-4-(3-cyanophenyl)-2-methyl-4-oxobutanoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)SC(C(=O)c1cccc(C#N)c1)[C@@H](C)C(=O)N1CSC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H18N2O5S2/c1-10(17(23)20-9-26-8-14(20)18(24)25)16(27-11(2)21)15(22)13-5-3-4-12(6-13)7-19/h3-6,10,14,16H,8-9H2,1-2H3,(H,24,25)/t10-,14+,16?/m1/s1 |
| InChIKey | JBZFNZIHVJHJFJ-NMGSQIIKSA-N |
| XLogP | 2.01 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|