About trimorpholin-4-yl borate
trimorpholin-4-yl borate (PubChem CID 57215155) has the molecular formula C12H24BN3O6
and a molecular weight of 317.15 g/mol. Its IUPAC name is trimorpholin-4-yl borate.
Molecular Properties
| Compound Name | trimorpholin-4-yl borate |
| PubChem CID | 57215155 |
| Molecular Formula | C12H24BN3O6 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | trimorpholin-4-yl borate |
| SMILES | C1CN(OB(ON2CCOCC2)ON2CCOCC2)CCO1 |
| InChI | InChI=1S/C12H24BN3O6/c1-7-17-8-2-14(1)20-13(21-15-3-9-18-10-4-15)22-16-5-11-19-12-6-16/h1-12H2 |
| InChIKey | BJTFIWFLIANNEW-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimorpholin-4-yl borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimorpholin-4-yl borate?
The IUPAC name of trimorpholin-4-yl borate (CID 57215155) is trimorpholin-4-yl borate.
What is the SMILES notation for trimorpholin-4-yl borate?
The canonical SMILES for trimorpholin-4-yl borate is C1CN(OB(ON2CCOCC2)ON2CCOCC2)CCO1.
What is the InChIKey of trimorpholin-4-yl borate?
The InChIKey is BJTFIWFLIANNEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24BN3O6/c1-7-17-8-2-14(1)20-13(21-15-3-9-18-10-4-15)22-16-5-11-19-12-6-16/h1-12H2.
What are the key properties of trimorpholin-4-yl borate?
trimorpholin-4-yl borate has a molecular weight of 317.15 g/mol, XLogP of -1.24, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for trimorpholin-4-yl borate is sourced from PubChem (CID 57215155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).