C6H3ClF2N2O2 — CID 57216899
N-(5-chloro-2,4-difluorophenyl)nitramide (PubChem CID 57216899) has the molecular formula C6H3ClF2N2O2 and a molecular weight of 208.55 g/mol. Its IUPAC name is N-(5-chloro-2,4-difluorophenyl)nitramide.
| Compound Name | N-(5-chloro-2,4-difluorophenyl)nitramide |
|---|---|
| PubChem CID | 57216899 |
| Molecular Formula | C6H3ClF2N2O2 |
| Molecular Weight | 208.55 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | N-(5-chloro-2,4-difluorophenyl)nitramide |
| SMILES | O=[N+]([O-])Nc1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C6H3ClF2N2O2/c7-3-1-6(10-11(12)13)5(9)2-4(3)8/h1-2,10H |
| InChIKey | BOVGCDDWSQCVAP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|