C6H2Cl4N2O2 — CID 22755541
N-(2,3,5,6-tetrachlorophenyl)nitramide (PubChem CID 22755541) has the molecular formula C6H2Cl4N2O2 and a molecular weight of 275.91 g/mol. Its IUPAC name is N-(2,3,5,6-tetrachlorophenyl)nitramide.
| Compound Name | N-(2,3,5,6-tetrachlorophenyl)nitramide |
|---|---|
| PubChem CID | 22755541 |
| Molecular Formula | C6H2Cl4N2O2 |
| Molecular Weight | 275.91 g/mol |
| Exact Mass | 273.89 |
| IUPAC Name | N-(2,3,5,6-tetrachlorophenyl)nitramide |
| SMILES | O=[N+]([O-])Nc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C6H2Cl4N2O2/c7-2-1-3(8)5(10)6(4(2)9)11-12(13)14/h1,11H |
| InChIKey | AHSTZDNKAGCTKO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.91 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|