C10H11Cl3N2O4 — CID 134088419
morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate (PubChem CID 134088419) has the molecular formula C10H11Cl3N2O4 and a molecular weight of 329.57 g/mol. Its IUPAC name is morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate.
| Compound Name | morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate |
|---|---|
| PubChem CID | 134088419 |
| Molecular Formula | C10H11Cl3N2O4 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate |
| SMILES | C1COCC[NH2+]1.O=[N+]([O-])c1c([O-])c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C6H2Cl3NO3.C4H9NO/c7-2-1-3(8)6(11)5(4(2)9)10(12)13;1-3-6-4-2-5-1/h1,11H;5H,1-4H2 |
| InChIKey | FWGXUSOSQFEREI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|