About morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate
morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate (PubChem CID 134088419) has the molecular formula C10H11Cl3N2O4
and a molecular weight of 329.57 g/mol. Its IUPAC name is morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate.
Molecular Properties
| Compound Name | morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate |
| PubChem CID | 134088419 |
| Molecular Formula | C10H11Cl3N2O4 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate |
| SMILES | C1COCC[NH2+]1.O=[N+]([O-])c1c([O-])c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C6H2Cl3NO3.C4H9NO/c7-2-1-3(8)6(11)5(4(2)9)10(12)13;1-3-6-4-2-5-1/h1,11H;5H,1-4H2 |
| InChIKey | FWGXUSOSQFEREI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate?
The IUPAC name of morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate (CID 134088419) is morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate.
What is the SMILES notation for morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate?
The canonical SMILES for morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate is C1COCC[NH2+]1.O=[N+]([O-])c1c([O-])c(Cl)cc(Cl)c1Cl.
What is the InChIKey of morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate?
The InChIKey is FWGXUSOSQFEREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl3NO3.C4H9NO/c7-2-1-3(8)6(11)5(4(2)9)10(12)13;1-3-6-4-2-5-1/h1,11H;5H,1-4H2.
What are the key properties of morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate?
morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate has a molecular weight of 329.57 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-ium;3,4,6-trichloro-2-nitrophenolate is sourced from PubChem (CID 134088419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).