C12H2Cl6N2O4S2 — CID 174649016
1,2,3-trichloro-4-nitro-5-[(3,4,5-trichloro-2-nitrophenyl)disulfanyl]benzene (PubChem CID 174649016) has the molecular formula C12H2Cl6N2O4S2 and a molecular weight of 515.01 g/mol. Its IUPAC name is 1,2,3-trichloro-4-nitro-5-[(3,4,5-trichloro-2-nitrophenyl)disulfanyl]benzene.
| Compound Name | 1,2,3-trichloro-4-nitro-5-[(3,4,5-trichloro-2-nitrophenyl)disulfanyl]benzene |
|---|---|
| PubChem CID | 174649016 |
| Molecular Formula | C12H2Cl6N2O4S2 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 511.76 |
| IUPAC Name | 1,2,3-trichloro-4-nitro-5-[(3,4,5-trichloro-2-nitrophenyl)disulfanyl]benzene |
| SMILES | O=[N+]([O-])c1c(SSc2cc(Cl)c(Cl)c(Cl)c2[N+](=O)[O-])cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H2Cl6N2O4S2/c13-3-1-5(11(19(21)22)9(17)7(3)15)25-26-6-2-4(14)8(16)10(18)12(6)20(23)24/h1-2H |
| InChIKey | XRAUYDHUMJMIJR-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|