C10H11Cl2N3O2 — CID 10891110
6,7-dichloro-1,4-dimethyl-5-nitro-2,3-dihydroquinoxaline (PubChem CID 10891110) has the molecular formula C10H11Cl2N3O2 and a molecular weight of 276.12 g/mol. Its IUPAC name is 6,7-dichloro-1,4-dimethyl-5-nitro-2,3-dihydroquinoxaline.
| Compound Name | 6,7-dichloro-1,4-dimethyl-5-nitro-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 10891110 |
| Molecular Formula | C10H11Cl2N3O2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 6,7-dichloro-1,4-dimethyl-5-nitro-2,3-dihydroquinoxaline |
| SMILES | CN1CCN(C)c2c1cc(Cl)c(Cl)c2[N+](=O)[O-] |
| InChI | InChI=1S/C10H11Cl2N3O2/c1-13-3-4-14(2)9-7(13)5-6(11)8(12)10(9)15(16)17/h5H,3-4H2,1-2H3 |
| InChIKey | HOOWAPOYMMHBKQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|