About 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate
6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate (PubChem CID 3693585) has the molecular formula C7HClNO5S-
and a molecular weight of 246.61 g/mol. Its IUPAC name is 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate.
Molecular Properties
| Compound Name | 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate |
| PubChem CID | 3693585 |
| Molecular Formula | C7HClNO5S- |
| Molecular Weight | 246.61 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate |
| SMILES | O=c1oc2cc(Cl)c([O-])c([N+](=O)[O-])c2s1 |
| InChI | InChI=1S/C7H2ClNO5S/c8-2-1-3-6(15-7(11)14-3)4(5(2)10)9(12)13/h1,10H/p-1 |
| InChIKey | PIYCWIMSQRUMRH-UHFFFAOYSA-M |
| XLogP | 1.49 |
| TPSA | 96.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.61 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate?
The IUPAC name of 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate (CID 3693585) is 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate.
What is the SMILES notation for 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate?
The canonical SMILES for 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate is O=c1oc2cc(Cl)c([O-])c([N+](=O)[O-])c2s1.
What is the InChIKey of 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate?
The InChIKey is PIYCWIMSQRUMRH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H2ClNO5S/c8-2-1-3-6(15-7(11)14-3)4(5(2)10)9(12)13/h1,10H/p-1.
What are the key properties of 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate?
6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate has a molecular weight of 246.61 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-nitro-2-oxo-1,3-benzoxathiol-5-olate is sourced from PubChem (CID 3693585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).