C8H4ClNO4S — CID 141328142
2-chloro-7-nitro-1-benzothiophene-5,6-diol (PubChem CID 141328142) has the molecular formula C8H4ClNO4S and a molecular weight of 245.64 g/mol. Its IUPAC name is 2-chloro-7-nitro-1-benzothiophene-5,6-diol.
| Compound Name | 2-chloro-7-nitro-1-benzothiophene-5,6-diol |
|---|---|
| PubChem CID | 141328142 |
| Molecular Formula | C8H4ClNO4S |
| Molecular Weight | 245.64 g/mol |
| Exact Mass | 244.95 |
| IUPAC Name | 2-chloro-7-nitro-1-benzothiophene-5,6-diol |
| SMILES | O=[N+]([O-])c1c(O)c(O)cc2cc(Cl)sc12 |
| InChI | InChI=1S/C8H4ClNO4S/c9-5-2-3-1-4(11)7(12)6(10(13)14)8(3)15-5/h1-2,11-12H |
| InChIKey | ZRUUQRNYJZNDNS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.64 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|