C16H9ClN2O7S — CID 15983100
4-[(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophene-2-carbonyl)amino]benzoic acid (PubChem CID 15983100) has the molecular formula C16H9ClN2O7S and a molecular weight of 408.78 g/mol. Its IUPAC name is 4-[(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophene-2-carbonyl)amino]benzoic acid.
| Compound Name | 4-[(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 15983100 |
| Molecular Formula | C16H9ClN2O7S |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 4-[(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophene-2-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2sc3c([N+](=O)[O-])c(O)c(O)cc3c2Cl)cc1 |
| InChI | InChI=1S/C16H9ClN2O7S/c17-10-8-5-9(20)12(21)11(19(25)26)13(8)27-14(10)15(22)18-7-3-1-6(2-4-7)16(23)24/h1-5,20-21H,(H,18,22)(H,23,24) |
| InChIKey | FJCPVOBRBLMXKC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|