C12H10ClNO6S — CID 46884906
propan-2-yl 3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylate (PubChem CID 46884906) has the molecular formula C12H10ClNO6S and a molecular weight of 331.73 g/mol. Its IUPAC name is propan-2-yl 3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | propan-2-yl 3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46884906 |
| Molecular Formula | C12H10ClNO6S |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | propan-2-yl 3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylate |
| SMILES | CC(C)OC(=O)c1sc2c([N+](=O)[O-])c(O)c(O)cc2c1Cl |
| InChI | InChI=1S/C12H10ClNO6S/c1-4(2)20-12(17)11-7(13)5-3-6(15)9(16)8(14(18)19)10(5)21-11/h3-4,15-16H,1-2H3 |
| InChIKey | POKYHCUJXGDDRU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|