C23H20N2O12S2 — CID 159188282
5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylic acid;methyl 5,6-diethoxy-7-nitro-1-benzothiophene-2-carboxylate (PubChem CID 159188282) has the molecular formula C23H20N2O12S2 and a molecular weight of 580.55 g/mol. Its IUPAC name is 5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylic acid;methyl 5,6-diethoxy-7-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | 5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylic acid;methyl 5,6-diethoxy-7-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 159188282 |
| Molecular Formula | C23H20N2O12S2 |
| Molecular Weight | 580.55 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | 5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylic acid;methyl 5,6-diethoxy-7-nitro-1-benzothiophene-2-carboxylate |
| SMILES | CCOc1cc2cc(C(=O)OC)sc2c([N+](=O)[O-])c1OCC.O=C(O)c1cc2cc(O)c(O)c([N+](=O)[O-])c2s1 |
| InChI | InChI=1S/C14H15NO6S.C9H5NO6S/c1-4-20-9-6-8-7-10(14(16)19-3)22-13(8)11(15(17)18)12(9)21-5-2;11-4-1-3-2-5(9(13)14)17-8(3)6(7(4)12)10(15)16/h6-7H,4-5H2,1-3H3;1-2,11-12H,(H,13,14) |
| InChIKey | KNTNKMSUOPYXBV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 208.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|