C25H21NO9S — CID 162065693
5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylic acid;3-ethoxy-4-phenylmethoxybenzaldehyde (PubChem CID 162065693) has the molecular formula C25H21NO9S and a molecular weight of 511.51 g/mol. Its IUPAC name is 5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylic acid;3-ethoxy-4-phenylmethoxybenzaldehyde.
| Compound Name | 5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylic acid;3-ethoxy-4-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 162065693 |
| Molecular Formula | C25H21NO9S |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 5,6-dihydroxy-7-nitro-1-benzothiophene-2-carboxylic acid;3-ethoxy-4-phenylmethoxybenzaldehyde |
| SMILES | CCOc1cc(C=O)ccc1OCc1ccccc1.O=C(O)c1cc2cc(O)c(O)c([N+](=O)[O-])c2s1 |
| InChI | InChI=1S/C16H16O3.C9H5NO6S/c1-2-18-16-10-14(11-17)8-9-15(16)19-12-13-6-4-3-5-7-13;11-4-1-3-2-5(9(13)14)17-8(3)6(7(4)12)10(15)16/h3-11H,2,12H2,1H3;1-2,11-12H,(H,13,14) |
| InChIKey | ZAKQYLVKZCFUON-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|