About methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate
methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 57217453) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate.
Analyze methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate?
The IUPAC name of methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate (CID 57217453) is methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate.
What is the SMILES notation for methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate?
The canonical SMILES for methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate is COC(=O)C1=CC(C)ON1.
What is the InChIKey of methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate?
The InChIKey is GMTFUUJTUCGCDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-4-3-5(7-10-4)6(8)9-2/h3-4,7H,1-2H3.
What are the key properties of methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate?
methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate has a molecular weight of 143.14 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-2,5-dihydro-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 57217453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).