C9H14N2O2 — CID 57219361
3-hydrazinylidene-2,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxylic acid (PubChem CID 57219361) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-hydrazinylidene-2,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxylic acid.
| Compound Name | 3-hydrazinylidene-2,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
|---|---|
| PubChem CID | 57219361 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-hydrazinylidene-2,3a,4,5,6,6a-hexahydro-1H-pentalene-2-carboxylic acid |
| SMILES | NN=C1C(C(=O)O)CC2CCCC12 |
| InChI | InChI=1S/C9H14N2O2/c10-11-8-6-3-1-2-5(6)4-7(8)9(12)13/h5-7H,1-4,10H2,(H,12,13) |
| InChIKey | GBZMDMNPBAGYIH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|