C10H16N2O2 — CID 57253104
3-hydrazinylidenespiro[4.4]nonane-2-carboxylic acid (PubChem CID 57253104) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-hydrazinylidenespiro[4.4]nonane-2-carboxylic acid.
| Compound Name | 3-hydrazinylidenespiro[4.4]nonane-2-carboxylic acid |
|---|---|
| PubChem CID | 57253104 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-hydrazinylidenespiro[4.4]nonane-2-carboxylic acid |
| SMILES | NN=C1CC2(CCCC2)CC1C(=O)O |
| InChI | InChI=1S/C10H16N2O2/c11-12-8-6-10(3-1-2-4-10)5-7(8)9(13)14/h7H,1-6,11H2,(H,13,14) |
| InChIKey | QEAJMFGPGYUWCB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|